C19H21NO3 — CID 26367875
(3R)-3-[(2,5-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one (PubChem CID 26367875) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3R)-3-[(2,5-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one.
| Compound Name | (3R)-3-[(2,5-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 26367875 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3R)-3-[(2,5-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one |
| SMILES | CCN1C(=O)[C@H](Cc2cc(OC)ccc2OC)c2ccccc21 |
| InChI | InChI=1S/C19H21NO3/c1-4-20-17-8-6-5-7-15(17)16(19(20)21)12-13-11-14(22-2)9-10-18(13)23-3/h5-11,16H,4,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | NMQUVTACCQRELS-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |