C24H23NO4 — CID 43912762
1-phenyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one (PubChem CID 43912762) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-phenyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one.
| Compound Name | 1-phenyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 43912762 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-phenyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one |
| SMILES | COc1ccc(CC2C(=O)N(c3ccccc3)c3ccccc32)c(OC)c1OC |
| InChI | InChI=1S/C24H23NO4/c1-27-21-14-13-16(22(28-2)23(21)29-3)15-19-18-11-7-8-12-20(18)25(24(19)26)17-9-5-4-6-10-17/h4-14,19H,15H2,1-3H3 |
| InChIKey | ZPXOUOFQHIZTAT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |