C18H18ClNO3 — CID 53044238
3-[(3-chloro-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 53044238) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-[(3-chloro-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one.
| Compound Name | 3-[(3-chloro-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 53044238 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[(3-chloro-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | COc1cc(CC2C(=O)N(C)c3ccccc32)cc(Cl)c1OC |
| InChI | InChI=1S/C18H18ClNO3/c1-20-15-7-5-4-6-12(15)13(18(20)21)8-11-9-14(19)17(23-3)16(10-11)22-2/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | CCXLFXRMZWFCTN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |