C19H20BrNO4 — CID 43912542
5-bromo-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one (PubChem CID 43912542) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one.
| Compound Name | 5-bromo-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 43912542 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 5-bromo-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-3H-indol-2-one |
| SMILES | COc1ccc(CC2C(=O)N(C)c3ccc(Br)cc32)c(OC)c1OC |
| InChI | InChI=1S/C19H20BrNO4/c1-21-15-7-6-12(20)10-13(15)14(19(21)22)9-11-5-8-16(23-2)18(25-4)17(11)24-3/h5-8,10,14H,9H2,1-4H3 |
| InChIKey | KEWQDNJWIQFNCM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |