C18H18N2O4 — CID 171982462
5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 171982462) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 171982462 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(CC2C(=O)N(C)C(=O)N(C)C2=O)c2ccccc12 |
| InChI | InChI=1S/C18H18N2O4/c1-19-16(21)14(17(22)20(2)18(19)23)10-11-8-9-15(24-3)13-7-5-4-6-12(11)13/h4-9,14H,10H2,1-3H3 |
| InChIKey | NUEMKMNRSJPARL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|