C16H16N2O2 — CID 131844513
(5R)-1,3-dimethyl-5-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione (PubChem CID 131844513) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (5R)-1,3-dimethyl-5-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-1,3-dimethyl-5-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131844513 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (5R)-1,3-dimethyl-5-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CN1C(=O)[C@@H](Cc2cccc3ccccc23)N(C)C1=O |
| InChI | InChI=1S/C16H16N2O2/c1-17-14(15(19)18(2)16(17)20)10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9,14H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | YFMYLXFAFJFWSF-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|