C6H10N2O2S — CID 87233904
1,3-dimethyl-5-(sulfanylmethyl)imidazolidine-2,4-dione (PubChem CID 87233904) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 1,3-dimethyl-5-(sulfanylmethyl)imidazolidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(sulfanylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87233904 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,3-dimethyl-5-(sulfanylmethyl)imidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(CS)N(C)C1=O |
| InChI | InChI=1S/C6H10N2O2S/c1-7-4(3-11)5(9)8(2)6(7)10/h4,11H,3H2,1-2H3 |
| InChIKey | UVTCTMDSRICILB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|