C19H15N3O4 — CID 164620180
(4R)-4-[(2-hydroxyphenyl)methyl]-2-methyl-4H-pyrazino[2,1-b]quinazoline-1,3,6-trione (PubChem CID 164620180) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is (4R)-4-[(2-hydroxyphenyl)methyl]-2-methyl-4H-pyrazino[2,1-b]quinazoline-1,3,6-trione.
| Compound Name | (4R)-4-[(2-hydroxyphenyl)methyl]-2-methyl-4H-pyrazino[2,1-b]quinazoline-1,3,6-trione |
|---|---|
| PubChem CID | 164620180 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (4R)-4-[(2-hydroxyphenyl)methyl]-2-methyl-4H-pyrazino[2,1-b]quinazoline-1,3,6-trione |
| SMILES | CN1C(=O)c2nc3ccccc3c(=O)n2[C@H](Cc2ccccc2O)C1=O |
| InChI | InChI=1S/C19H15N3O4/c1-21-18(25)14(10-11-6-2-5-9-15(11)23)22-16(19(21)26)20-13-8-4-3-7-12(13)17(22)24/h2-9,14,23H,10H2,1H3/t14-/m1/s1 |
| InChIKey | HXQLNVLJMJWBDA-CQSZACIVSA-N |
| XLogP | 1.50 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|