C23H18N4O2S — CID 10525850
9-(1H-indol-3-ylmethyl)-4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,12,14,16-pentaene-8,11-dione (PubChem CID 10525850) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 9-(1H-indol-3-ylmethyl)-4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,12,14,16-pentaene-8,11-dione.
| Compound Name | 9-(1H-indol-3-ylmethyl)-4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,12,14,16-pentaene-8,11-dione |
|---|---|
| PubChem CID | 10525850 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 9-(1H-indol-3-ylmethyl)-4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,12,14,16-pentaene-8,11-dione |
| SMILES | O=C1C(Cc2c[nH]c3ccccc23)n2c(nc3ccccc3c2=O)C2=CSCCN12 |
| InChI | InChI=1S/C23H18N4O2S/c28-22-16-6-2-4-8-18(16)25-21-20-13-30-10-9-26(20)23(29)19(27(21)22)11-14-12-24-17-7-3-1-5-15(14)17/h1-8,12-13,19,24H,9-11H2 |
| InChIKey | VXZQKYUYXRTZFB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |