C23H20N4O3S — CID 101101445
(2R,9S)-9-(1H-indol-3-ylmethyl)-4-oxo-4λ4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),12,14,16-tetraene-8,11-dione (PubChem CID 101101445) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is (2R,9S)-9-(1H-indol-3-ylmethyl)-4-oxo-4λ4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),12,14,16-tetraene-8,11-dione.
| Compound Name | (2R,9S)-9-(1H-indol-3-ylmethyl)-4-oxo-4λ4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),12,14,16-tetraene-8,11-dione |
|---|---|
| PubChem CID | 101101445 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (2R,9S)-9-(1H-indol-3-ylmethyl)-4-oxo-4λ4-thia-7,10,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),12,14,16-tetraene-8,11-dione |
| SMILES | O=C1[C@H](Cc2c[nH]c3ccccc23)n2c(nc3ccccc3c2=O)[C@@H]2CS(=O)CCN12 |
| InChI | InChI=1S/C23H20N4O3S/c28-22-16-6-2-4-8-18(16)25-21-20-13-31(30)10-9-26(20)23(29)19(27(21)22)11-14-12-24-17-7-3-1-5-15(14)17/h1-8,12,19-20,24H,9-11,13H2/t19-,20-,31?/m0/s1 |
| InChIKey | XNTRUIBDUJXTDD-XYITUZTBSA-N |
| XLogP | 2.31 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |