C12H12N4O — CID 11528712
5-(1H-indol-3-ylmethyl)-4,5-dihydro-2H-1,2,4-triazin-3-one (PubChem CID 11528712) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-(1H-indol-3-ylmethyl)-4,5-dihydro-2H-1,2,4-triazin-3-one.
| Compound Name | 5-(1H-indol-3-ylmethyl)-4,5-dihydro-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 11528712 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(1H-indol-3-ylmethyl)-4,5-dihydro-2H-1,2,4-triazin-3-one |
| SMILES | O=C1NN=CC(Cc2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C12H12N4O/c17-12-15-9(7-14-16-12)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6-7,9,13H,5H2,(H2,15,16,17) |
| InChIKey | XPAOFZLUEPSPFP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |