C18H15N3 — CID 71352644
(3R)-3-(1H-indol-3-ylmethyl)-3H-1,4-benzodiazepine (PubChem CID 71352644) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is (3R)-3-(1H-indol-3-ylmethyl)-3H-1,4-benzodiazepine.
| Compound Name | (3R)-3-(1H-indol-3-ylmethyl)-3H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 71352644 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3R)-3-(1H-indol-3-ylmethyl)-3H-1,4-benzodiazepine |
| SMILES | C1=Nc2ccccc2C=N[C@@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15N3/c1-3-7-17-13(5-1)10-19-15(12-21-17)9-14-11-20-18-8-4-2-6-16(14)18/h1-8,10-12,15,20H,9H2/t15-/m1/s1 |
| InChIKey | PRBGPHVSMYLABR-OAHLLOKOSA-N |
| XLogP | 3.91 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |