C19H21N3O3 — CID 101030387
(7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-2-prop-2-enyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 101030387) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-2-prop-2-enyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-2-prop-2-enyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 101030387 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-2-prop-2-enyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C=CCN1C(=O)C2C[C@@H](O)CN2C(=O)C1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H21N3O3/c1-2-7-21-16(8-12-10-20-15-6-4-3-5-14(12)15)19(25)22-11-13(23)9-17(22)18(21)24/h2-6,10,13,16-17,20,23H,1,7-9,11H2/t13-,16?,17?/m1/s1 |
| InChIKey | ZKAJSJWQZLBZGH-NVPAJSRCSA-N |
| XLogP | 1.07 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|