C16H20N2O — CID 110126404
(3aS,6aR)-2-(1H-indol-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 110126404) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (3aS,6aR)-2-(1H-indol-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aS,6aR)-2-(1H-indol-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 110126404 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (3aS,6aR)-2-(1H-indol-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | OC1C[C@@H]2CN(Cc3c[nH]c4ccccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C16H20N2O/c19-14-5-11-8-18(9-12(11)6-14)10-13-7-17-16-4-2-1-3-15(13)16/h1-4,7,11-12,14,17,19H,5-6,8-10H2/t11-,12+,14? |
| InChIKey | MAKDVKOGDOCXDY-ONXXMXGDSA-N |
| XLogP | 2.37 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |