C23H20N4O2S — CID 10835722
(11S,17S)-17-(1H-indol-3-ylmethyl)-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione (PubChem CID 10835722) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is (11S,17S)-17-(1H-indol-3-ylmethyl)-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione.
| Compound Name | (11S,17S)-17-(1H-indol-3-ylmethyl)-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione |
|---|---|
| PubChem CID | 10835722 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (11S,17S)-17-(1H-indol-3-ylmethyl)-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione |
| SMILES | C[C@@]12SCCN1C(=O)[C@H](Cc1c[nH]c3ccccc13)n1c2nc2ccccc2c1=O |
| InChI | InChI=1S/C23H20N4O2S/c1-23-22-25-18-9-5-3-7-16(18)20(28)27(22)19(21(29)26(23)10-11-30-23)12-14-13-24-17-8-4-2-6-15(14)17/h2-9,13,19,24H,10-12H2,1H3/t19-,23-/m0/s1 |
| InChIKey | PYNLKZSPJKKXIF-CVDCTZTESA-N |
| XLogP | 3.42 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |