C22H21N3O3S — CID 10811372
(11S,17R)-17-[(3-methoxyphenyl)methyl]-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione (PubChem CID 10811372) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is (11S,17R)-17-[(3-methoxyphenyl)methyl]-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione.
| Compound Name | (11S,17R)-17-[(3-methoxyphenyl)methyl]-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione |
|---|---|
| PubChem CID | 10811372 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (11S,17R)-17-[(3-methoxyphenyl)methyl]-11-methyl-12-thia-1,9,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9-tetraene-2,16-dione |
| SMILES | COc1cccc(C[C@@H]2C(=O)N3CCS[C@@]3(C)c3nc4ccccc4c(=O)n32)c1 |
| InChI | InChI=1S/C22H21N3O3S/c1-22-21-23-17-9-4-3-8-16(17)19(26)25(21)18(20(27)24(22)10-11-29-22)13-14-6-5-7-15(12-14)28-2/h3-9,12,18H,10-11,13H2,1-2H3/t18-,22+/m1/s1 |
| InChIKey | SNMGAWUUZUBZEV-GCJKJVERSA-N |
| XLogP | 2.95 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |