C23H23N5O2 — CID 156641717
(11S)-14-(1H-indol-3-ylmethyl)-11-(2-methylpropyl)-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene-2,13-dione (PubChem CID 156641717) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (11S)-14-(1H-indol-3-ylmethyl)-11-(2-methylpropyl)-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene-2,13-dione.
| Compound Name | (11S)-14-(1H-indol-3-ylmethyl)-11-(2-methylpropyl)-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene-2,13-dione |
|---|---|
| PubChem CID | 156641717 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (11S)-14-(1H-indol-3-ylmethyl)-11-(2-methylpropyl)-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene-2,13-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)C(Cc2c[nH]c3ccccc23)n2c1nc1cnccc1c2=O |
| InChI | InChI=1S/C23H23N5O2/c1-13(2)9-18-21-26-19-12-24-8-7-16(19)23(30)28(21)20(22(29)27-18)10-14-11-25-17-6-4-3-5-15(14)17/h3-8,11-13,18,20,25H,9-10H2,1-2H3,(H,27,29)/t18-,20?/m0/s1 |
| InChIKey | QLMPNNNTPGLVEA-LROBGIAVSA-N |
| XLogP | 3.27 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |