C30H43N7O3 — CID 166618791
(10R,13S)-10-(1H-indol-3-ylmethyl)-16-methyl-4-(3-methylbutanoyl)-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166618791) has the molecular formula C30H43N7O3 and a molecular weight of 549.72 g/mol. Its IUPAC name is (10R,13S)-10-(1H-indol-3-ylmethyl)-16-methyl-4-(3-methylbutanoyl)-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10R,13S)-10-(1H-indol-3-ylmethyl)-16-methyl-4-(3-methylbutanoyl)-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166618791 |
| Molecular Formula | C30H43N7O3 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | (10R,13S)-10-(1H-indol-3-ylmethyl)-16-methyl-4-(3-methylbutanoyl)-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)CC(C)C)CCCC(=O)N[C@H](Cc1c[nH]c3ccccc13)C(=O)N[C@H]2CC(C)C |
| InChI | InChI=1S/C30H43N7O3/c1-19(2)15-25-29-32-21(5)35-37(29)14-13-36(28(39)16-20(3)4)12-8-11-27(38)33-26(30(40)34-25)17-22-18-31-24-10-7-6-9-23(22)24/h6-7,9-10,18-20,25-26,31H,8,11-17H2,1-5H3,(H,33,38)(H,34,40)/t25-,26+/m0/s1 |
| InChIKey | SSYNCIISTYFEFE-IZZNHLLZSA-N |
| XLogP | 3.67 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |