C24H38N6O3 — CID 166622216
(10S,13R)-4-(cyclopent-3-ene-1-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166622216) has the molecular formula C24H38N6O3 and a molecular weight of 458.61 g/mol. Its IUPAC name is (10S,13R)-4-(cyclopent-3-ene-1-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-4-(cyclopent-3-ene-1-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166622216 |
| Molecular Formula | C24H38N6O3 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (10S,13R)-4-(cyclopent-3-ene-1-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)C1CC=CC1)CCCC(=O)N(C)[C@@H](C)C(=O)N[C@@H]2CC(C)C |
| InChI | InChI=1S/C24H38N6O3/c1-16(2)15-20-22-25-18(4)27-30(22)14-13-29(24(33)19-9-6-7-10-19)12-8-11-21(31)28(5)17(3)23(32)26-20/h6-7,16-17,19-20H,8-15H2,1-5H3,(H,26,32)/t17-,20+/m0/s1 |
| InChIKey | QNYARTHYSRHZRB-FXAWDEMLSA-N |
| XLogP | 2.23 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|