C26H37ClN6O4 — CID 166615724
(10S,13R)-4-[2-(2-chlorophenoxy)acetyl]-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166615724) has the molecular formula C26H37ClN6O4 and a molecular weight of 533.07 g/mol. Its IUPAC name is (10S,13R)-4-[2-(2-chlorophenoxy)acetyl]-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-4-[2-(2-chlorophenoxy)acetyl]-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166615724 |
| Molecular Formula | C26H37ClN6O4 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (10S,13R)-4-[2-(2-chlorophenoxy)acetyl]-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)COc1ccccc1Cl)CCCC(=O)N(C)[C@@H](C)C(=O)N[C@@H]2CC(C)C |
| InChI | InChI=1S/C26H37ClN6O4/c1-17(2)15-21-25-28-19(4)30-33(25)14-13-32(24(35)16-37-22-10-7-6-9-20(22)27)12-8-11-23(34)31(5)18(3)26(36)29-21/h6-7,9-10,17-18,21H,8,11-16H2,1-5H3,(H,29,36)/t18-,21+/m0/s1 |
| InChIKey | UJHXFHLUCRZWOF-GHTZIAJQSA-N |
| XLogP | 2.99 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |