C30H37N7O4 — CID 166613565
(1S,4R)-4-benzyl-7-methyl-12-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione (PubChem CID 166613565) has the molecular formula C30H37N7O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is (1S,4R)-4-benzyl-7-methyl-12-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4R)-4-benzyl-7-methyl-12-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166613565 |
| Molecular Formula | C30H37N7O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | (1S,4R)-4-benzyl-7-methyl-12-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1ccc(C)[nH]c1=O)CCCC(=O)N1CCCC[C@H]1C(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C30H37N7O4/c1-20-13-14-23(28(39)31-20)30(41)35-15-8-12-26(38)36-16-7-6-11-25(36)29(40)33-24(19-22-9-4-3-5-10-22)27-32-21(2)34-37(27)18-17-35/h3-5,9-10,13-14,24-25H,6-8,11-12,15-19H2,1-2H3,(H,31,39)(H,33,40)/t24-,25+/m1/s1 |
| InChIKey | UBZWOJTUNOQLBF-RPBOFIJWSA-N |
| XLogP | 2.30 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |