C25H34N6O4 — CID 166621108
(1S,4R)-4-benzyl-12-(2-hydroxyacetyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione (PubChem CID 166621108) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is (1S,4R)-4-benzyl-12-(2-hydroxyacetyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4R)-4-benzyl-12-(2-hydroxyacetyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166621108 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (1S,4R)-4-benzyl-12-(2-hydroxyacetyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)CO)CCCC(=O)N1CCCC[C@H]1C(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C25H34N6O4/c1-18-26-24-20(16-19-8-3-2-4-9-19)27-25(35)21-10-5-6-13-30(21)22(33)11-7-12-29(23(34)17-32)14-15-31(24)28-18/h2-4,8-9,20-21,32H,5-7,10-17H2,1H3,(H,27,35)/t20-,21+/m1/s1 |
| InChIKey | ZVDCXBGDRFUDKP-RTWAWAEBSA-N |
| XLogP | 0.98 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |