C33H41N7O4 — CID 166617934
(1S,4R)-4-benzyl-7-methyl-12-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione (PubChem CID 166617934) has the molecular formula C33H41N7O4 and a molecular weight of 599.74 g/mol. Its IUPAC name is (1S,4R)-4-benzyl-7-methyl-12-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4R)-4-benzyl-7-methyl-12-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166617934 |
| Molecular Formula | C33H41N7O4 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | (1S,4R)-4-benzyl-7-methyl-12-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1[nH]c3c(c1C)C(=O)CCC3)CCCC(=O)N1CCCC[C@H]1C(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C33H41N7O4/c1-21-29-24(12-8-14-27(29)41)35-30(21)33(44)38-16-9-15-28(42)39-17-7-6-13-26(39)32(43)36-25(20-23-10-4-3-5-11-23)31-34-22(2)37-40(31)19-18-38/h3-5,10-11,25-26,35H,6-9,12-20H2,1-2H3,(H,36,43)/t25-,26+/m1/s1 |
| InChIKey | MQODTRUQMBOQBJ-FTJBHMTQSA-N |
| XLogP | 3.46 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |