C32H41N7O5S — CID 166614713
5-[(1S,4R)-4-benzyl-7-methyl-2,16-dioxo-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-12-carbonyl]-2,3-dimethylbenzenesulfonamide (PubChem CID 166614713) has the molecular formula C32H41N7O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is 5-[(1S,4R)-4-benzyl-7-methyl-2,16-dioxo-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-12-carbonyl]-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-[(1S,4R)-4-benzyl-7-methyl-2,16-dioxo-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-12-carbonyl]-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166614713 |
| Molecular Formula | C32H41N7O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 5-[(1S,4R)-4-benzyl-7-methyl-2,16-dioxo-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-12-carbonyl]-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1cc(C)c(C)c(S(N)(=O)=O)c1)CCCC(=O)N1CCCC[C@H]1C(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C32H41N7O5S/c1-21-18-25(20-28(22(21)2)45(33,43)44)32(42)37-14-9-13-29(40)38-15-8-7-12-27(38)31(41)35-26(19-24-10-5-4-6-11-24)30-34-23(3)36-39(30)17-16-37/h4-6,10-11,18,20,26-27H,7-9,12-17,19H2,1-3H3,(H,35,41)(H2,33,43,44)/t26-,27+/m1/s1 |
| InChIKey | DPZGKOMUMVCIMB-SXOMAYOGSA-N |
| XLogP | 2.57 |
| TPSA | 160.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |