C31H37FN6O3 — CID 166615097
(1S,4R)-4-benzyl-12-(2-fluoro-6-methylbenzoyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione (PubChem CID 166615097) has the molecular formula C31H37FN6O3 and a molecular weight of 560.67 g/mol. Its IUPAC name is (1S,4R)-4-benzyl-12-(2-fluoro-6-methylbenzoyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4R)-4-benzyl-12-(2-fluoro-6-methylbenzoyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166615097 |
| Molecular Formula | C31H37FN6O3 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (1S,4R)-4-benzyl-12-(2-fluoro-6-methylbenzoyl)-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1c(C)cccc1F)CCCC(=O)N1CCCC[C@H]1C(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C31H37FN6O3/c1-21-10-8-13-24(32)28(21)31(41)36-16-9-15-27(39)37-17-7-6-14-26(37)30(40)34-25(20-23-11-4-3-5-12-23)29-33-22(2)35-38(29)19-18-36/h3-5,8,10-13,25-26H,6-7,9,14-20H2,1-2H3,(H,34,40)/t25-,26+/m1/s1 |
| InChIKey | WNIVAYIKKCGASO-FTJBHMTQSA-N |
| XLogP | 3.75 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |