C29H39N9O3 — CID 166617570
(10S,13R)-4-(2-anilinopyrimidine-5-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166617570) has the molecular formula C29H39N9O3 and a molecular weight of 561.69 g/mol. Its IUPAC name is (10S,13R)-4-(2-anilinopyrimidine-5-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-4-(2-anilinopyrimidine-5-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166617570 |
| Molecular Formula | C29H39N9O3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | (10S,13R)-4-(2-anilinopyrimidine-5-carbonyl)-9,10,16-trimethyl-13-(2-methylpropyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1cnc(Nc3ccccc3)nc1)CCCC(=O)N(C)[C@@H](C)C(=O)N[C@@H]2CC(C)C |
| InChI | InChI=1S/C29H39N9O3/c1-19(2)16-24-26-32-21(4)35-38(26)15-14-37(13-9-12-25(39)36(5)20(3)27(40)34-24)28(41)22-17-30-29(31-18-22)33-23-10-7-6-8-11-23/h6-8,10-11,17-20,24H,9,12-16H2,1-5H3,(H,34,40)(H,30,31,33)/t20-,24+/m0/s1 |
| InChIKey | XJXUUPIAUFTMIX-GBXCKJPGSA-N |
| XLogP | 3.11 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |