C27H40N6O3 — CID 166616942
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2-methylpropanoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166616942) has the molecular formula C27H40N6O3 and a molecular weight of 496.66 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2-methylpropanoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2-methylpropanoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166616942 |
| Molecular Formula | C27H40N6O3 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2-methylpropanoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)C(C)C)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C27H40N6O3/c1-6-19(4)24-26(35)29-22(17-21-11-8-7-9-12-21)25-28-20(5)31-33(25)16-15-32(27(36)18(2)3)14-10-13-23(34)30-24/h7-9,11-12,18-19,22,24H,6,10,13-17H2,1-5H3,(H,29,35)(H,30,34)/t19-,22-,24-/m0/s1 |
| InChIKey | UCORCZJHOXIOIL-APTRMMRNSA-N |
| XLogP | 2.80 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |