C27H37N9O3 — CID 166621636
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(5-methyl-2H-triazole-4-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166621636) has the molecular formula C27H37N9O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(5-methyl-2H-triazole-4-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(5-methyl-2H-triazole-4-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166621636 |
| Molecular Formula | C27H37N9O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(5-methyl-2H-triazole-4-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2n[nH]nc2C)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C27H37N9O3/c1-5-17(2)23-26(38)29-21(16-20-10-7-6-8-11-20)25-28-19(4)33-36(25)15-14-35(13-9-12-22(37)30-23)27(39)24-18(3)31-34-32-24/h6-8,10-11,17,21,23H,5,9,12-16H2,1-4H3,(H,29,38)(H,30,37)(H,31,32,34)/t17-,21-,23-/m0/s1 |
| InChIKey | RKAUBNAHVXHSHL-HYVJGQCMSA-N |
| XLogP | 1.88 |
| TPSA | 150.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |