C31H44N8O5 — CID 171331060
(10S,13R)-10-benzyl-4-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione;formic acid (PubChem CID 171331060) has the molecular formula C31H44N8O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is (10S,13R)-10-benzyl-4-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione;formic acid.
| Compound Name | (10S,13R)-10-benzyl-4-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione;formic acid |
|---|---|
| PubChem CID | 171331060 |
| Molecular Formula | C31H44N8O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | (10S,13R)-10-benzyl-4-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione;formic acid |
| SMILES | CCn1nc(C)c(C(=O)N2CCCC(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@H](C(C)C)c3nc(C)nn3CC2)c1C.O=CO |
| InChI | InChI=1S/C30H42N8O3.CH2O2/c1-7-37-21(5)26(20(4)34-37)30(41)36-15-11-14-25(39)32-24(18-23-12-9-8-10-13-23)29(40)33-27(19(2)3)28-31-22(6)35-38(28)17-16-36;2-1-3/h8-10,12-13,19,24,27H,7,11,14-18H2,1-6H3,(H,32,39)(H,33,40);1H,(H,2,3)/t24-,27+;/m0./s1 |
| InChIKey | JHXJXGCYQAVFBK-LHIMUUITSA-N |
| XLogP | 2.60 |
| TPSA | 164.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|