C30H35N7O3S — CID 166614178
(10S,13R)-4-(1,3-benzothiazole-6-carbonyl)-10-benzyl-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166614178) has the molecular formula C30H35N7O3S and a molecular weight of 573.72 g/mol. Its IUPAC name is (10S,13R)-4-(1,3-benzothiazole-6-carbonyl)-10-benzyl-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-4-(1,3-benzothiazole-6-carbonyl)-10-benzyl-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166614178 |
| Molecular Formula | C30H35N7O3S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (10S,13R)-4-(1,3-benzothiazole-6-carbonyl)-10-benzyl-16-methyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2n(n1)CCN(C(=O)c1ccc3ncsc3c1)CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]2C(C)C |
| InChI | InChI=1S/C30H35N7O3S/c1-19(2)27-28-32-20(3)35-37(28)15-14-36(30(40)22-11-12-23-25(17-22)41-18-31-23)13-7-10-26(38)33-24(29(39)34-27)16-21-8-5-4-6-9-21/h4-6,8-9,11-12,17-19,24,27H,7,10,13-16H2,1-3H3,(H,33,38)(H,34,39)/t24-,27+/m0/s1 |
| InChIKey | IIBPYLRDOYBRPE-RPLLCQBOSA-N |
| XLogP | 3.67 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |