C29H37N7O3 — CID 166615437
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(pyridine-3-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166615437) has the molecular formula C29H37N7O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(pyridine-3-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(pyridine-3-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166615437 |
| Molecular Formula | C29H37N7O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(pyridine-3-carbonyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2cccnc2)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C29H37N7O3/c1-4-20(2)26-28(38)32-24(18-22-10-6-5-7-11-22)27-31-21(3)34-36(27)17-16-35(15-9-13-25(37)33-26)29(39)23-12-8-14-30-19-23/h5-8,10-12,14,19-20,24,26H,4,9,13,15-18H2,1-3H3,(H,32,38)(H,33,37)/t20-,24-,26-/m0/s1 |
| InChIKey | WXXWWEHOUSJWKH-RJWMVNQGSA-N |
| XLogP | 2.85 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |