C32H40N6O4 — CID 166620112
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(1,3-dihydro-2-benzofuran-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166620112) has the molecular formula C32H40N6O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(1,3-dihydro-2-benzofuran-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(1,3-dihydro-2-benzofuran-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166620112 |
| Molecular Formula | C32H40N6O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(1,3-dihydro-2-benzofuran-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2cccc3c2COC3)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C32H40N6O4/c1-4-21(2)29-31(40)34-27(18-23-10-6-5-7-11-23)30-33-22(3)36-38(30)17-16-37(15-9-14-28(39)35-29)32(41)25-13-8-12-24-19-42-20-26(24)25/h5-8,10-13,21,27,29H,4,9,14-20H2,1-3H3,(H,34,40)(H,35,39)/t21-,27-,29-/m0/s1 |
| InChIKey | GKPMDWDDYFWGCF-SSKOMTKWSA-N |
| XLogP | 3.48 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |