C33H44N6O6 — CID 166620002
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2,4,5-trimethoxybenzoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166620002) has the molecular formula C33H44N6O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2,4,5-trimethoxybenzoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2,4,5-trimethoxybenzoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166620002 |
| Molecular Formula | C33H44N6O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-(2,4,5-trimethoxybenzoyl)-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2cc(OC)c(OC)cc2OC)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C33H44N6O6/c1-7-21(2)30-32(41)35-25(18-23-12-9-8-10-13-23)31-34-22(3)37-39(31)17-16-38(15-11-14-29(40)36-30)33(42)24-19-27(44-5)28(45-6)20-26(24)43-4/h8-10,12-13,19-21,25,30H,7,11,14-18H2,1-6H3,(H,35,41)(H,36,40)/t21-,25-,30-/m0/s1 |
| InChIKey | WVOYPBDBQHNFNN-YJHYVVDTSA-N |
| XLogP | 3.48 |
| TPSA | 136.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |