C36H50N8O3 — CID 166621217
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166621217) has the molecular formula C36H50N8O3 and a molecular weight of 642.85 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166621217 |
| Molecular Formula | C36H50N8O3 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-16-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)CN2CCN(c3cccc(C)c3)CC2)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C36H50N8O3/c1-5-27(3)34-36(47)38-31(24-29-12-7-6-8-13-29)35-37-28(4)40-44(35)22-21-43(16-10-15-32(45)39-34)33(46)25-41-17-19-42(20-18-41)30-14-9-11-26(2)23-30/h6-9,11-14,23,27,31,34H,5,10,15-22,24-25H2,1-4H3,(H,38,47)(H,39,45)/t27-,31-,34-/m0/s1 |
| InChIKey | VYZPWZGISHMXOR-IHZCURHOSA-N |
| XLogP | 3.27 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |