C29H39N7O4 — CID 166620657
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166620657) has the molecular formula C29H39N7O4 and a molecular weight of 549.68 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166620657 |
| Molecular Formula | C29H39N7O4 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2c(C)noc2C)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C29H39N7O4/c1-6-18(2)26-28(38)31-23(17-22-11-8-7-9-12-22)27-30-21(5)33-36(27)16-15-35(14-10-13-24(37)32-26)29(39)25-19(3)34-40-20(25)4/h7-9,11-12,18,23,26H,6,10,13-17H2,1-5H3,(H,31,38)(H,32,37)/t18-,23-,26-/m0/s1 |
| InChIKey | OGEBYPKCTUNGBL-WMDMVVLCSA-N |
| XLogP | 3.06 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |