C34H42N8O3 — CID 166617747
(10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(2,3-dimethylquinoxaline-6-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166617747) has the molecular formula C34H42N8O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(2,3-dimethylquinoxaline-6-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(2,3-dimethylquinoxaline-6-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166617747 |
| Molecular Formula | C34H42N8O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (10S,13S)-13-benzyl-10-[(2S)-butan-2-yl]-4-(2,3-dimethylquinoxaline-6-carbonyl)-16-methyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2ccc3nc(C)c(C)nc3c2)CCn2nc(C)nc2[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H42N8O3/c1-6-21(2)31-33(44)38-29(19-25-11-8-7-9-12-25)32-37-24(5)40-42(32)18-17-41(16-10-13-30(43)39-31)34(45)26-14-15-27-28(20-26)36-23(4)22(3)35-27/h7-9,11-12,14-15,20-21,29,31H,6,10,13,16-19H2,1-5H3,(H,38,44)(H,39,43)/t21-,29-,31-/m0/s1 |
| InChIKey | ZJZIOZOXRYZWRA-DSBWAUOBSA-N |
| XLogP | 4.01 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |