C28H40N6O4 — CID 166616906
(10R,13R)-13-methyl-10-(2-methylpropyl)-4-(oxane-4-carbonyl)-16-phenyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166616906) has the molecular formula C28H40N6O4 and a molecular weight of 524.67 g/mol. Its IUPAC name is (10R,13R)-13-methyl-10-(2-methylpropyl)-4-(oxane-4-carbonyl)-16-phenyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10R,13R)-13-methyl-10-(2-methylpropyl)-4-(oxane-4-carbonyl)-16-phenyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166616906 |
| Molecular Formula | C28H40N6O4 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | (10R,13R)-13-methyl-10-(2-methylpropyl)-4-(oxane-4-carbonyl)-16-phenyl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CC(C)C[C@H]1NC(=O)CCCN(C(=O)C2CCOCC2)CCn2nc(-c3ccccc3)nc2[C@@H](C)NC1=O |
| InChI | InChI=1S/C28H40N6O4/c1-19(2)18-23-27(36)29-20(3)26-31-25(21-8-5-4-6-9-21)32-34(26)15-14-33(13-7-10-24(35)30-23)28(37)22-11-16-38-17-12-22/h4-6,8-9,19-20,22-23H,7,10-18H2,1-3H3,(H,29,36)(H,30,35)/t20-,23-/m1/s1 |
| InChIKey | RLMQMHRQDRQCFO-NFBKMPQASA-N |
| XLogP | 2.70 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |