C26H34N6O4 — CID 166617118
(1S,4S)-4-methyl-12-[(2S)-oxolane-2-carbonyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione (PubChem CID 166617118) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is (1S,4S)-4-methyl-12-[(2S)-oxolane-2-carbonyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4S)-4-methyl-12-[(2S)-oxolane-2-carbonyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166617118 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (1S,4S)-4-methyl-12-[(2S)-oxolane-2-carbonyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
| SMILES | C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)CCCN(C(=O)[C@@H]2CCCO2)CCn2nc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C26H34N6O4/c1-18-24-28-23(19-8-3-2-4-9-19)29-32(24)16-15-30(26(35)21-11-7-17-36-21)13-6-12-22(33)31-14-5-10-20(31)25(34)27-18/h2-4,8-9,18,20-21H,5-7,10-17H2,1H3,(H,27,34)/t18-,20-,21-/m0/s1 |
| InChIKey | RNSKDHUZBUVBJG-JBACZVJFSA-N |
| XLogP | 1.91 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |