C32H38N8O3 — CID 166618875
(10R,13S)-4-(2,3-dimethylquinoxaline-6-carbonyl)-10-methyl-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166618875) has the molecular formula C32H38N8O3 and a molecular weight of 582.71 g/mol. Its IUPAC name is (10R,13S)-4-(2,3-dimethylquinoxaline-6-carbonyl)-10-methyl-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10R,13S)-4-(2,3-dimethylquinoxaline-6-carbonyl)-10-methyl-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166618875 |
| Molecular Formula | C32H38N8O3 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | (10R,13S)-4-(2,3-dimethylquinoxaline-6-carbonyl)-10-methyl-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | Cc1nc2ccc(C(=O)N3CCCC(=O)N[C@H](C)C(=O)N[C@@H](C(C)C)c4nc(-c5ccccc5)nn4CC3)cc2nc1C |
| InChI | InChI=1S/C32H38N8O3/c1-19(2)28-30-37-29(23-10-7-6-8-11-23)38-40(30)17-16-39(15-9-12-27(41)35-22(5)31(42)36-28)32(43)24-13-14-25-26(18-24)34-21(4)20(3)33-25/h6-8,10-11,13-14,18-19,22,28H,9,12,15-17H2,1-5H3,(H,35,41)(H,36,42)/t22-,28+/m1/s1 |
| InChIKey | VESBYHUSFGNAJF-DFHRPNOPSA-N |
| XLogP | 3.76 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |