C32H40N6O3S — CID 166614848
(10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(E)-3-phenylprop-2-enoyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166614848) has the molecular formula C32H40N6O3S and a molecular weight of 588.78 g/mol. Its IUPAC name is (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(E)-3-phenylprop-2-enoyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(E)-3-phenylprop-2-enoyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166614848 |
| Molecular Formula | C32H40N6O3S |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(E)-3-phenylprop-2-enoyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CSCC[C@@H]1NC(=O)CCCN(C(=O)/C=C/c2ccccc2)CCn2nc(-c3ccccc3)nc2[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C32H40N6O3S/c1-23(2)29-31-35-30(25-13-8-5-9-14-25)36-38(31)21-20-37(28(40)17-16-24-11-6-4-7-12-24)19-10-15-27(39)33-26(18-22-42-3)32(41)34-29/h4-9,11-14,16-17,23,26,29H,10,15,18-22H2,1-3H3,(H,33,39)(H,34,41)/b17-16+/t26-,29+/m0/s1 |
| InChIKey | YGYALZOZDXUTHF-IWRIWKIUSA-N |
| XLogP | 4.33 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|