C30H44N6O3S — CID 166617736
(10S,13R)-4-(5-methylhex-4-enoyl)-10-(2-methylsulfanylethyl)-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166617736) has the molecular formula C30H44N6O3S and a molecular weight of 568.79 g/mol. Its IUPAC name is (10S,13R)-4-(5-methylhex-4-enoyl)-10-(2-methylsulfanylethyl)-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-4-(5-methylhex-4-enoyl)-10-(2-methylsulfanylethyl)-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166617736 |
| Molecular Formula | C30H44N6O3S |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | (10S,13R)-4-(5-methylhex-4-enoyl)-10-(2-methylsulfanylethyl)-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CSCC[C@@H]1NC(=O)CCCN(C(=O)CCC=C(C)C)CCn2nc(-c3ccccc3)nc2[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C30H44N6O3S/c1-21(2)11-9-15-26(38)35-17-10-14-25(37)31-24(16-20-40-5)30(39)32-27(22(3)4)29-33-28(34-36(29)19-18-35)23-12-7-6-8-13-23/h6-8,11-13,22,24,27H,9-10,14-20H2,1-5H3,(H,31,37)(H,32,39)/t24-,27+/m0/s1 |
| InChIKey | NAIFRKBGPHXBNO-RPLLCQBOSA-N |
| XLogP | 4.37 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|