C32H42N6O5S2 — CID 166615435
(10S,13R)-10-(2-methylsulfanylethyl)-4-[2-(4-methylsulfonylphenyl)acetyl]-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166615435) has the molecular formula C32H42N6O5S2 and a molecular weight of 654.86 g/mol. Its IUPAC name is (10S,13R)-10-(2-methylsulfanylethyl)-4-[2-(4-methylsulfonylphenyl)acetyl]-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-10-(2-methylsulfanylethyl)-4-[2-(4-methylsulfonylphenyl)acetyl]-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166615435 |
| Molecular Formula | C32H42N6O5S2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | (10S,13R)-10-(2-methylsulfanylethyl)-4-[2-(4-methylsulfonylphenyl)acetyl]-16-phenyl-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CSCC[C@@H]1NC(=O)CCCN(C(=O)Cc2ccc(S(C)(=O)=O)cc2)CCn2nc(-c3ccccc3)nc2[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C32H42N6O5S2/c1-22(2)29-31-35-30(24-9-6-5-7-10-24)36-38(31)19-18-37(28(40)21-23-12-14-25(15-13-23)45(4,42)43)17-8-11-27(39)33-26(16-20-44-3)32(41)34-29/h5-7,9-10,12-15,22,26,29H,8,11,16-21H2,1-4H3,(H,33,39)(H,34,41)/t26-,29+/m0/s1 |
| InChIKey | SPQWYSPQXVLTHS-LITSAYRRSA-N |
| XLogP | 3.26 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |