C29H43N7O3S — CID 166617914
(10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(3S)-piperidine-3-carbonyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione (PubChem CID 166617914) has the molecular formula C29H43N7O3S and a molecular weight of 569.78 g/mol. Its IUPAC name is (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(3S)-piperidine-3-carbonyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione.
| Compound Name | (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(3S)-piperidine-3-carbonyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
|---|---|
| PubChem CID | 166617914 |
| Molecular Formula | C29H43N7O3S |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | (10S,13R)-10-(2-methylsulfanylethyl)-16-phenyl-4-[(3S)-piperidine-3-carbonyl]-13-propan-2-yl-1,4,9,12,15,17-hexazabicyclo[12.3.0]heptadeca-14,16-diene-8,11-dione |
| SMILES | CSCC[C@@H]1NC(=O)CCCN(C(=O)[C@H]2CCCNC2)CCn2nc(-c3ccccc3)nc2[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C29H43N7O3S/c1-20(2)25-27-33-26(21-9-5-4-6-10-21)34-36(27)17-16-35(29(39)22-11-7-14-30-19-22)15-8-12-24(37)31-23(13-18-40-3)28(38)32-25/h4-6,9-10,20,22-23,25,30H,7-8,11-19H2,1-3H3,(H,31,37)(H,32,38)/t22-,23-,25+/m0/s1 |
| InChIKey | ZNZLQIOTVQUDFP-SONWIMMPSA-N |
| XLogP | 2.62 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |