C21H30N6O2 — CID 52525383
[(2S)-oxolan-2-yl]-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]methanone (PubChem CID 52525383) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]methanone.
| Compound Name | [(2S)-oxolan-2-yl]-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 52525383 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | [(2S)-oxolan-2-yl]-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CCN(CCCCCn2nnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H30N6O2/c28-21(19-10-7-17-29-19)26-15-13-25(14-16-26)11-5-2-6-12-27-23-20(22-24-27)18-8-3-1-4-9-18/h1,3-4,8-9,19H,2,5-7,10-17H2/t19-/m0/s1 |
| InChIKey | IDHWODGERRIQLN-IBGZPJMESA-N |
| XLogP | 1.83 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|