C15H20N6O2S — CID 9111092
[(2R)-oxolan-2-yl]-[4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 9111092) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]-[4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(2R)-oxolan-2-yl]-[4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9111092 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(2R)-oxolan-2-yl]-[4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C([C@H]1CCCO1)N1CCN(Cn2nnc(-c3cccs3)n2)CC1 |
| InChI | InChI=1S/C15H20N6O2S/c22-15(12-3-1-9-23-12)20-7-5-19(6-8-20)11-21-17-14(16-18-21)13-4-2-10-24-13/h2,4,10,12H,1,3,5-9,11H2/t12-/m1/s1 |
| InChIKey | MCWFKXZCLREUFG-GFCCVEGCSA-N |
| XLogP | 0.68 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |