C16H21N5OS — CID 17475815
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(5-thiophen-2-yltetrazol-2-yl)ethanone (PubChem CID 17475815) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(5-thiophen-2-yltetrazol-2-yl)ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(5-thiophen-2-yltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 17475815 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(5-thiophen-2-yltetrazol-2-yl)ethanone |
| SMILES | O=C(Cn1nnc(-c2cccs2)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H21N5OS/c22-15(20-9-3-6-12-5-1-2-7-13(12)20)11-21-18-16(17-19-21)14-8-4-10-23-14/h4,8,10,12-13H,1-3,5-7,9,11H2 |
| InChIKey | MZBFNVCNQOJMSQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |