C34H50N8O5 — CID 137342108
(12R,15R,18S)-8-(cycloheptanecarbonyl)-12,18-dimethyl-15-(2-methylpropyl)-21-phenyl-1,4,8,11,14,17,20,22-octazabicyclo[17.3.0]docosa-19,21-diene-3,10,13,16-tetrone (PubChem CID 137342108) has the molecular formula C34H50N8O5 and a molecular weight of 650.83 g/mol. Its IUPAC name is (12R,15R,18S)-8-(cycloheptanecarbonyl)-12,18-dimethyl-15-(2-methylpropyl)-21-phenyl-1,4,8,11,14,17,20,22-octazabicyclo[17.3.0]docosa-19,21-diene-3,10,13,16-tetrone.
| Compound Name | (12R,15R,18S)-8-(cycloheptanecarbonyl)-12,18-dimethyl-15-(2-methylpropyl)-21-phenyl-1,4,8,11,14,17,20,22-octazabicyclo[17.3.0]docosa-19,21-diene-3,10,13,16-tetrone |
|---|---|
| PubChem CID | 137342108 |
| Molecular Formula | C34H50N8O5 |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | (12R,15R,18S)-8-(cycloheptanecarbonyl)-12,18-dimethyl-15-(2-methylpropyl)-21-phenyl-1,4,8,11,14,17,20,22-octazabicyclo[17.3.0]docosa-19,21-diene-3,10,13,16-tetrone |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)NC(=O)CN(C(=O)C2CCCCCC2)CCCNC(=O)Cn2nc(-c3ccccc3)nc2[C@H](C)NC1=O |
| InChI | InChI=1S/C34H50N8O5/c1-22(2)19-27-33(46)37-23(3)31-39-30(25-13-10-7-11-14-25)40-42(31)21-28(43)35-17-12-18-41(20-29(44)36-24(4)32(45)38-27)34(47)26-15-8-5-6-9-16-26/h7,10-11,13-14,22-24,26-27H,5-6,8-9,12,15-21H2,1-4H3,(H,35,43)(H,36,44)(H,37,46)(H,38,45)/t23-,24+,27+/m0/s1 |
| InChIKey | XQQSXARKRFGNGN-CLCZQPDDSA-N |
| XLogP | 2.48 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |