About sodium;1-ethylnaphthalene;hydride
sodium;1-ethylnaphthalene;hydride (PubChem CID 174300793) has the molecular formula C12H13Na
and a molecular weight of 180.23 g/mol. Its IUPAC name is sodium;1-ethylnaphthalene;hydride.
Molecular Properties
| Compound Name | sodium;1-ethylnaphthalene;hydride |
| PubChem CID | 174300793 |
| Molecular Formula | C12H13Na |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | sodium;1-ethylnaphthalene;hydride |
| SMILES | CCc1cccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C12H12.Na.H/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;;/h3-9H,2H2,1H3;;/q;+1;-1 |
| InChIKey | ISHIQIQRBHDULM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sodium;1-ethylnaphthalene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-ethylnaphthalene;hydride?
The IUPAC name of sodium;1-ethylnaphthalene;hydride (CID 174300793) is sodium;1-ethylnaphthalene;hydride.
What is the SMILES notation for sodium;1-ethylnaphthalene;hydride?
The canonical SMILES for sodium;1-ethylnaphthalene;hydride is CCc1cccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;1-ethylnaphthalene;hydride?
The InChIKey is ISHIQIQRBHDULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.Na.H/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;;/h3-9H,2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;1-ethylnaphthalene;hydride?
sodium;1-ethylnaphthalene;hydride has a molecular weight of 180.23 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-ethylnaphthalene;hydride is sourced from PubChem (CID 174300793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).