About 1-ethylnaphthalene;methylcyclopropane
1-ethylnaphthalene;methylcyclopropane (PubChem CID 142069670) has the molecular formula C16H20
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-ethylnaphthalene;methylcyclopropane.
Molecular Properties
| Compound Name | 1-ethylnaphthalene;methylcyclopropane |
| PubChem CID | 142069670 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 1-ethylnaphthalene;methylcyclopropane |
| SMILES | CC1CC1.CCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12.C4H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-4-2-3-4/h3-9H,2H2,1H3;4H,2-3H2,1H3 |
| InChIKey | GNNUSNCWFJRPCL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethylnaphthalene;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylnaphthalene;methylcyclopropane?
The IUPAC name of 1-ethylnaphthalene;methylcyclopropane (CID 142069670) is 1-ethylnaphthalene;methylcyclopropane.
What is the SMILES notation for 1-ethylnaphthalene;methylcyclopropane?
The canonical SMILES for 1-ethylnaphthalene;methylcyclopropane is CC1CC1.CCc1cccc2ccccc12.
What is the InChIKey of 1-ethylnaphthalene;methylcyclopropane?
The InChIKey is GNNUSNCWFJRPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C4H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-4-2-3-4/h3-9H,2H2,1H3;4H,2-3H2,1H3.
What are the key properties of 1-ethylnaphthalene;methylcyclopropane?
1-ethylnaphthalene;methylcyclopropane has a molecular weight of 212.34 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylnaphthalene;methylcyclopropane is sourced from PubChem (CID 142069670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).