About 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine
1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine (PubChem CID 142138952) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine.
Molecular Properties
| Compound Name | 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine |
| PubChem CID | 142138952 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine |
| SMILES | C=C(C)NC(=C)C.CCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12.C6H11N/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-5(2)7-6(3)4/h3-9H,2H2,1H3;7H,1,3H2,2,4H3 |
| InChIKey | JHGMROMEXCMIDC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine?
The IUPAC name of 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine (CID 142138952) is 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine.
What is the SMILES notation for 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine?
The canonical SMILES for 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine is C=C(C)NC(=C)C.CCc1cccc2ccccc12.
What is the InChIKey of 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine?
The InChIKey is JHGMROMEXCMIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C6H11N/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-5(2)7-6(3)4/h3-9H,2H2,1H3;7H,1,3H2,2,4H3.
What are the key properties of 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine?
1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine has a molecular weight of 253.39 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylnaphthalene;N-prop-1-en-2-ylprop-1-en-2-amine is sourced from PubChem (CID 142138952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).